C32H23ClN4O4S — CID 19131467
(5Z)-5-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-2,6-dioxo-4-phenylpyridine-3-carbonitrile (PubChem CID 19131467) has the molecular formula C32H23ClN4O4S and a molecular weight of 595.08 g/mol. Its IUPAC name is (5Z)-5-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-2,6-dioxo-4-phenylpyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-2,6-dioxo-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19131467 |
| Molecular Formula | C32H23ClN4O4S |
| Molecular Weight | 595.08 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | (5Z)-5-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-(1,1-dioxothiolan-3-yl)-2,6-dioxo-4-phenylpyridine-3-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)/C(=C/c2cn(-c3ccccc3)nc2-c2ccc(Cl)cc2)C(=O)N(C2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C32H23ClN4O4S/c33-24-13-11-22(12-14-24)30-23(19-36(35-30)25-9-5-2-6-10-25)17-27-29(21-7-3-1-4-8-21)28(18-34)32(39)37(31(27)38)26-15-16-42(40,41)20-26/h1-14,17,19,26H,15-16,20H2/b27-17- |
| InChIKey | UIADCKSTNXOYLI-PKAZHMFMSA-N |
| XLogP | 5.11 |
| TPSA | 113.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.08 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|