C33H33N5O4S — CID 19112156
(5E)-1-cyclopentyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile (PubChem CID 19112156) has the molecular formula C33H33N5O4S and a molecular weight of 595.73 g/mol. Its IUPAC name is (5E)-1-cyclopentyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile.
| Compound Name | (5E)-1-cyclopentyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112156 |
| Molecular Formula | C33H33N5O4S |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | (5E)-1-cyclopentyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C2CCCC2)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C33H33N5O4S/c1-23-29(32(39)38(27-12-6-7-13-27)33(40)30(23)21-34)20-25-22-37(26-10-4-2-5-11-26)35-31(25)24-14-16-28(17-15-24)43(41,42)36-18-8-3-9-19-36/h2,4-5,10-11,14-17,20,22,27H,3,6-9,12-13,18-19H2,1H3/b29-20+ |
| InChIKey | HWHFYZGBMNSFEH-ZTKZIYFRSA-N |
| XLogP | 5.25 |
| TPSA | 116.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|