C31H31N5O5S — CID 19110518
(5E)-4-methyl-1-(2-methylpropyl)-5-[[3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19110518) has the molecular formula C31H31N5O5S and a molecular weight of 585.69 g/mol. Its IUPAC name is (5E)-4-methyl-1-(2-methylpropyl)-5-[[3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-1-(2-methylpropyl)-5-[[3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19110518 |
| Molecular Formula | C31H31N5O5S |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | (5E)-4-methyl-1-(2-methylpropyl)-5-[[3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(CC(C)C)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C31H31N5O5S/c1-21(2)19-35-30(37)27(22(3)28(18-32)31(35)38)17-24-20-36(25-7-5-4-6-8-25)33-29(24)23-9-11-26(12-10-23)42(39,40)34-13-15-41-16-14-34/h4-12,17,20-21H,13-16,19H2,1-3H3/b27-17+ |
| InChIKey | BRZZYWHAXBEWBC-WPWMEQJKSA-N |
| XLogP | 3.81 |
| TPSA | 125.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|