C31H31N5O4S — CID 19110237
(5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-1-propan-2-ylpyridine-3-carbonitrile (PubChem CID 19110237) has the molecular formula C31H31N5O4S and a molecular weight of 569.69 g/mol. Its IUPAC name is (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-1-propan-2-ylpyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-1-propan-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19110237 |
| Molecular Formula | C31H31N5O4S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-piperidin-1-ylsulfonylphenyl)pyrazol-4-yl]methylidene]-1-propan-2-ylpyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C(C)C)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C31H31N5O4S/c1-21(2)36-30(37)27(22(3)28(19-32)31(36)38)18-24-20-35(25-10-6-4-7-11-25)33-29(24)23-12-14-26(15-13-23)41(39,40)34-16-8-5-9-17-34/h4,6-7,10-15,18,20-21H,5,8-9,16-17H2,1-3H3/b27-18+ |
| InChIKey | RAPYYUHVAIWRGB-OVVQPSECSA-N |
| XLogP | 4.71 |
| TPSA | 116.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|