C30H29N5O6S — CID 19110799
(5E)-1-(2-methoxyethyl)-4-methyl-5-[[3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19110799) has the molecular formula C30H29N5O6S and a molecular weight of 587.66 g/mol. Its IUPAC name is (5E)-1-(2-methoxyethyl)-4-methyl-5-[[3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-(2-methoxyethyl)-4-methyl-5-[[3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19110799 |
| Molecular Formula | C30H29N5O6S |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | (5E)-1-(2-methoxyethyl)-4-methyl-5-[[3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COCCN1C(=O)C(C#N)=C(C)/C(=C\c2cn(-c3ccccc3)nc2-c2ccc(S(=O)(=O)N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C30H29N5O6S/c1-21-26(29(36)34(14-15-40-2)30(37)27(21)19-31)18-23-20-35(24-6-4-3-5-7-24)32-28(23)22-8-10-25(11-9-22)42(38,39)33-12-16-41-17-13-33/h3-11,18,20H,12-17H2,1-2H3/b26-18+ |
| InChIKey | KWTCFYUQGMVGLZ-NLRVBDNBSA-N |
| XLogP | 2.80 |
| TPSA | 134.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|