C32H32N4O3S — CID 19111632
(5E)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile (PubChem CID 19111632) has the molecular formula C32H32N4O3S and a molecular weight of 552.70 g/mol. Its IUPAC name is (5E)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111632 |
| Molecular Formula | C32H32N4O3S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | (5E)-5-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile |
| SMILES | CCCCSc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CC3CCCO3)C(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C32H32N4O3S/c1-3-4-17-40-27-14-12-23(13-15-27)30-24(20-36(34-30)25-9-6-5-7-10-25)18-28-22(2)29(19-33)32(38)35(31(28)37)21-26-11-8-16-39-26/h5-7,9-10,12-15,18,20,26H,3-4,8,11,16-17,21H2,1-2H3/b28-18+ |
| InChIKey | MUDQJGSGPUJNDC-MTDXEUNCSA-N |
| XLogP | 6.20 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|