C31H28N4O4 — CID 19111622
(5E)-4-methyl-5-[[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile (PubChem CID 19111622) has the molecular formula C31H28N4O4 and a molecular weight of 520.59 g/mol. Its IUPAC name is (5E)-4-methyl-5-[[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-5-[[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111622 |
| Molecular Formula | C31H28N4O4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | (5E)-4-methyl-5-[[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(CC2CCCO2)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc2c(c1)CC(C)O2 |
| InChI | InChI=1S/C31H28N4O4/c1-19-13-22-14-21(10-11-28(22)39-19)29-23(17-35(33-29)24-7-4-3-5-8-24)15-26-20(2)27(16-32)31(37)34(30(26)36)18-25-9-6-12-38-25/h3-5,7-8,10-11,14-15,17,19,25H,6,9,12-13,18H2,1-2H3/b26-15+ |
| InChIKey | ZSCFKILAKCTCSW-CVKSISIWSA-N |
| XLogP | 4.63 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|