C32H34N4O3 — CID 19111634
(5E)-5-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile (PubChem CID 19111634) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is (5E)-5-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111634 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | (5E)-5-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-(oxolan-2-ylmethyl)pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(CC2CCCO2)C(=O)/C1=C/c1cn(-c2ccccc2)nc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H34N4O3/c1-20-27(30(37)35(31(38)28(20)17-33)19-26-8-5-9-39-26)13-24-18-36(25-6-3-2-4-7-25)34-29(24)32-14-21-10-22(15-32)12-23(11-21)16-32/h2-4,6-7,13,18,21-23,26H,5,8-12,14-16,19H2,1H3/b27-13+ |
| InChIKey | IVOQVVGZPZPGNY-UVHMKAGCSA-N |
| XLogP | 5.11 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|