C28H26N4O2 — CID 19109530
(5E)-1-ethyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile (PubChem CID 19109530) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is (5E)-1-ethyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile.
| Compound Name | (5E)-1-ethyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19109530 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (5E)-1-ethyl-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
| SMILES | CCN1C(=O)C(C#N)=C(C)/C(=C\c2cn(-c3ccccc3)nc2-c2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C28H26N4O2/c1-6-31-27(33)23(20(5)24(15-29)28(31)34)14-21-16-32(22-10-8-7-9-11-22)30-26(21)25-18(3)12-17(2)13-19(25)4/h7-14,16H,6H2,1-5H3/b23-14+ |
| InChIKey | JLLGJJRQGRWWRU-OEAKJJBVSA-N |
| XLogP | 5.08 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|