C32H27N5O2 — CID 19111358
(5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile (PubChem CID 19111358) has the molecular formula C32H27N5O2 and a molecular weight of 513.60 g/mol. Its IUPAC name is (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111358 |
| Molecular Formula | C32H27N5O2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(2,4,6-trimethylphenyl)pyrazol-4-yl]methylidene]-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2cccnc2)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C32H27N5O2/c1-20-13-21(2)29(22(3)14-20)30-25(19-37(35-30)26-10-6-5-7-11-26)15-27-23(4)28(16-33)32(39)36(31(27)38)18-24-9-8-12-34-17-24/h5-15,17,19H,18H2,1-4H3/b27-15+ |
| InChIKey | HLEQZIRDBYYCAF-JFLMPSFJSA-N |
| XLogP | 5.65 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|