C29H20N6O4 — CID 19111367
(5E)-4-methyl-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile (PubChem CID 19111367) has the molecular formula C29H20N6O4 and a molecular weight of 516.52 g/mol. Its IUPAC name is (5E)-4-methyl-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111367 |
| Molecular Formula | C29H20N6O4 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | (5E)-4-methyl-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2cccnc2)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H20N6O4/c1-19-25(28(36)33(29(37)26(19)15-30)17-20-6-5-13-31-16-20)14-22-18-34(23-7-3-2-4-8-23)32-27(22)21-9-11-24(12-10-21)35(38)39/h2-14,16,18H,17H2,1H3/b25-14+ |
| InChIKey | YATQXMXNPDQOKF-AFUMVMLFSA-N |
| XLogP | 4.63 |
| TPSA | 135.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|