C33H29N5O3 — CID 19111391
(5E)-4-methyl-5-[[3-(3-methyl-4-propan-2-yloxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile (PubChem CID 19111391) has the molecular formula C33H29N5O3 and a molecular weight of 543.63 g/mol. Its IUPAC name is (5E)-4-methyl-5-[[3-(3-methyl-4-propan-2-yloxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-5-[[3-(3-methyl-4-propan-2-yloxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111391 |
| Molecular Formula | C33H29N5O3 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | (5E)-4-methyl-5-[[3-(3-methyl-4-propan-2-yloxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2cccnc2)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc(OC(C)C)c(C)c1 |
| InChI | InChI=1S/C33H29N5O3/c1-21(2)41-30-13-12-25(15-22(30)3)31-26(20-38(36-31)27-10-6-5-7-11-27)16-28-23(4)29(17-34)33(40)37(32(28)39)19-24-9-8-14-35-18-24/h5-16,18,20-21H,19H2,1-4H3/b28-16+ |
| InChIKey | IDUBWDJRSCPCGE-LQKURTRISA-N |
| XLogP | 5.82 |
| TPSA | 101.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|