C29H26N4O4 — CID 19113434
2-[(5E)-3-cyano-5-[[3-(2,5-dimethylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethyl acetate (PubChem CID 19113434) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-[(5E)-3-cyano-5-[[3-(2,5-dimethylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethyl acetate.
| Compound Name | 2-[(5E)-3-cyano-5-[[3-(2,5-dimethylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethyl acetate |
|---|---|
| PubChem CID | 19113434 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-[(5E)-3-cyano-5-[[3-(2,5-dimethylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethyl acetate |
| SMILES | CC(=O)OCCN1C(=O)C(C#N)=C(C)/C(=C\c2cn(-c3ccccc3)nc2-c2cc(C)ccc2C)C1=O |
| InChI | InChI=1S/C29H26N4O4/c1-18-10-11-19(2)24(14-18)27-22(17-33(31-27)23-8-6-5-7-9-23)15-25-20(3)26(16-30)29(36)32(28(25)35)12-13-37-21(4)34/h5-11,14-15,17H,12-13H2,1-4H3/b25-15+ |
| InChIKey | WPDRMIHOYKBNTN-MFKUBSTISA-N |
| XLogP | 4.31 |
| TPSA | 105.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|