C21H21NO6S — CID 136832314
ethyl 4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate (PubChem CID 136832314) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is ethyl 4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate.
| Compound Name | ethyl 4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 136832314 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | ethyl 4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c1c(/C=N/[C@@H]1CCS(=O)(=O)C1)c(O)c1ccccc12 |
| InChI | InChI=1S/C21H21NO6S/c1-3-27-21(24)17-12(2)28-20-15-7-5-4-6-14(15)19(23)16(18(17)20)10-22-13-8-9-29(25,26)11-13/h4-7,10,13,23H,3,8-9,11H2,1-2H3/b22-10+/t13-/m1/s1 |
| InChIKey | PYAHCANWMVTMGR-HKXVIOCSSA-N |
| XLogP | 3.38 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|