C25H30NO4+ — CID 2353781
ethyl 9-cycloheptyl-4-methyl-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene-5-carboxylate (PubChem CID 2353781) has the molecular formula C25H30NO4+ and a molecular weight of 408.52 g/mol. Its IUPAC name is ethyl 9-cycloheptyl-4-methyl-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene-5-carboxylate.
| Compound Name | ethyl 9-cycloheptyl-4-methyl-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 2353781 |
| Molecular Formula | C25H30NO4+ |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | ethyl 9-cycloheptyl-4-methyl-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c1c1c(c3ccccc32)OC[NH+](C2CCCCCC2)C1 |
| InChI | InChI=1S/C25H29NO4/c1-3-28-25(27)21-16(2)30-24-19-13-9-8-12-18(19)23-20(22(21)24)14-26(15-29-23)17-10-6-4-5-7-11-17/h8-9,12-13,17H,3-7,10-11,14-15H2,1-2H3/p+1 |
| InChIKey | GBGMIYIMBIQEMD-UHFFFAOYSA-O |
| XLogP | 4.53 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |