C23H30N2O4+2 — CID 3447351
ethyl 4-[(4-ethylpiperazine-1,4-diium-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate (PubChem CID 3447351) has the molecular formula C23H30N2O4+2 and a molecular weight of 398.50 g/mol. Its IUPAC name is ethyl 4-[(4-ethylpiperazine-1,4-diium-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate.
| Compound Name | ethyl 4-[(4-ethylpiperazine-1,4-diium-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 3447351 |
| Molecular Formula | C23H30N2O4+2 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | ethyl 4-[(4-ethylpiperazine-1,4-diium-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c1c(C[NH+]1CC[NH+](CC)CC1)c(O)c1ccccc12 |
| InChI | InChI=1S/C23H28N2O4/c1-4-24-10-12-25(13-11-24)14-18-20-19(23(27)28-5-2)15(3)29-22(20)17-9-7-6-8-16(17)21(18)26/h6-9,26H,4-5,10-14H2,1-3H3/p+2 |
| InChIKey | QPCFEUQBFHHPKV-UHFFFAOYSA-P |
| XLogP | 1.08 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|