C28H29NO4 — CID 4581768
ethyl 5-hydroxy-2-methyl-4-[(4-methylphenyl)-pyrrolidin-1-ylmethyl]benzo[g][1]benzofuran-3-carboxylate (PubChem CID 4581768) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is ethyl 5-hydroxy-2-methyl-4-[(4-methylphenyl)-pyrrolidin-1-ylmethyl]benzo[g][1]benzofuran-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-2-methyl-4-[(4-methylphenyl)-pyrrolidin-1-ylmethyl]benzo[g][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 4581768 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | ethyl 5-hydroxy-2-methyl-4-[(4-methylphenyl)-pyrrolidin-1-ylmethyl]benzo[g][1]benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2c1c(C(c1ccc(C)cc1)N1CCCC1)c(O)c1ccccc12 |
| InChI | InChI=1S/C28H29NO4/c1-4-32-28(31)22-18(3)33-27-21-10-6-5-9-20(21)26(30)24(23(22)27)25(29-15-7-8-16-29)19-13-11-17(2)12-14-19/h5-6,9-14,25,30H,4,7-8,15-16H2,1-3H3 |
| InChIKey | MFGPNBZKRBMEIK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|