C25H24NO3+ — CID 4108798
1-[4-methyl-9-(1-phenylethyl)-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaen-5-yl]ethanone (PubChem CID 4108798) has the molecular formula C25H24NO3+ and a molecular weight of 386.47 g/mol. Its IUPAC name is 1-[4-methyl-9-(1-phenylethyl)-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaen-5-yl]ethanone.
| Compound Name | 1-[4-methyl-9-(1-phenylethyl)-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaen-5-yl]ethanone |
|---|---|
| PubChem CID | 4108798 |
| Molecular Formula | C25H24NO3+ |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[4-methyl-9-(1-phenylethyl)-3,11-dioxa-9-azoniatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaen-5-yl]ethanone |
| SMILES | CC(=O)c1c(C)oc2c1c1c(c3ccccc32)OC[NH+](C(C)c2ccccc2)C1 |
| InChI | InChI=1S/C25H23NO3/c1-15(18-9-5-4-6-10-18)26-13-21-23-22(16(2)27)17(3)29-25(23)20-12-8-7-11-19(20)24(21)28-14-26/h4-12,15H,13-14H2,1-3H3/p+1 |
| InChIKey | WIWGHIBFYDMOPF-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |