C24H27N3O4 — CID 7639680
(4S)-2-(4-methoxyphenyl)-4-(3-morpholin-4-ylpropyliminomethyl)-4H-isoquinoline-1,3-dione (PubChem CID 7639680) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (4S)-2-(4-methoxyphenyl)-4-(3-morpholin-4-ylpropyliminomethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4S)-2-(4-methoxyphenyl)-4-(3-morpholin-4-ylpropyliminomethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7639680 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (4S)-2-(4-methoxyphenyl)-4-(3-morpholin-4-ylpropyliminomethyl)-4H-isoquinoline-1,3-dione |
| SMILES | COc1ccc(N2C(=O)c3ccccc3[C@@H](/C=N/CCCN3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-30-19-9-7-18(8-10-19)27-23(28)21-6-3-2-5-20(21)22(24(27)29)17-25-11-4-12-26-13-15-31-16-14-26/h2-3,5-10,17,22H,4,11-16H2,1H3/b25-17+/t22-/m1/s1 |
| InChIKey | JQEHCCOEULIXQF-YALBQKEFSA-N |
| XLogP | 2.76 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|