C18H23N5O4 — CID 7368076
(5S)-1-(4-methoxyphenyl)-5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7368076) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is (5S)-1-(4-methoxyphenyl)-5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-1-(4-methoxyphenyl)-5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7368076 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (5S)-1-(4-methoxyphenyl)-5-(2-piperazin-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(N2C(=O)NC(=O)[C@H](/C=N/CCN3CCNCC3)C2=O)cc1 |
| InChI | InChI=1S/C18H23N5O4/c1-27-14-4-2-13(3-5-14)23-17(25)15(16(24)21-18(23)26)12-20-8-11-22-9-6-19-7-10-22/h2-5,12,15,19H,6-11H2,1H3,(H,21,24,26)/b20-12+/t15-/m0/s1 |
| InChIKey | BUYPMEZIVUJKFC-SLDJAQPHSA-N |
| XLogP | -0.13 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|