C19H15N3O6 — CID 41016845
4-[[(5R)-1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzoic acid (PubChem CID 41016845) has the molecular formula C19H15N3O6 and a molecular weight of 381.34 g/mol. Its IUPAC name is 4-[[(5R)-1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzoic acid.
| Compound Name | 4-[[(5R)-1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 41016845 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 4-[[(5R)-1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]benzoic acid |
| SMILES | COc1ccc(N2C(=O)NC(=O)[C@@H](/C=N/c3ccc(C(=O)O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H15N3O6/c1-28-14-8-6-13(7-9-14)22-17(24)15(16(23)21-19(22)27)10-20-12-4-2-11(3-5-12)18(25)26/h2-10,15H,1H3,(H,25,26)(H,21,23,27)/b20-10+/t15-/m1/s1 |
| InChIKey | JBLUIHDNDPAXIK-IXJMWADBSA-N |
| XLogP | 1.99 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|