C18H14N4O6 — CID 7340663
(5R)-1-(4-methoxyphenyl)-5-[(3-nitrophenyl)iminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7340663) has the molecular formula C18H14N4O6 and a molecular weight of 382.33 g/mol. Its IUPAC name is (5R)-1-(4-methoxyphenyl)-5-[(3-nitrophenyl)iminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-(4-methoxyphenyl)-5-[(3-nitrophenyl)iminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7340663 |
| Molecular Formula | C18H14N4O6 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (5R)-1-(4-methoxyphenyl)-5-[(3-nitrophenyl)iminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(N2C(=O)NC(=O)[C@@H](/C=N/c3cccc([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C18H14N4O6/c1-28-14-7-5-12(6-8-14)21-17(24)15(16(23)20-18(21)25)10-19-11-3-2-4-13(9-11)22(26)27/h2-10,15H,1H3,(H,20,23,25)/b19-10+/t15-/m1/s1 |
| InChIKey | NUOKYAZGDWFGOE-GDXCHIGESA-N |
| XLogP | 2.20 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|