C17H13N3O3S — CID 7921974
(5R)-5-[(3-hydroxyphenyl)iminomethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7921974) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is (5R)-5-[(3-hydroxyphenyl)iminomethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5R)-5-[(3-hydroxyphenyl)iminomethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7921974 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (5R)-5-[(3-hydroxyphenyl)iminomethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccccc2)C(=O)[C@@H]1/C=N/c1cccc(O)c1 |
| InChI | InChI=1S/C17H13N3O3S/c21-13-8-4-5-11(9-13)18-10-14-15(22)19-17(24)20(16(14)23)12-6-2-1-3-7-12/h1-10,14,21H,(H,19,22,24)/b18-10+/t14-/m1/s1 |
| InChIKey | KEXQJMMEHGKVCQ-YFEUJDIGSA-N |
| XLogP | 2.16 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|