C27H19N5O3S — CID 126054746
N-[(E)-[(5S)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126054746) has the molecular formula C27H19N5O3S and a molecular weight of 493.55 g/mol. Its IUPAC name is N-[(E)-[(5S)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[(5S)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126054746 |
| Molecular Formula | C27H19N5O3S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-[(E)-[(5S)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C/[C@H]1C(=O)NC(=S)N(c2ccccc2)C1=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C27H19N5O3S/c33-24-21(26(35)32(27(36)30-24)18-11-5-2-6-12-18)16-28-31-25(34)20-15-23(17-9-3-1-4-10-17)29-22-14-8-7-13-19(20)22/h1-16,21H,(H,31,34)(H,30,33,36)/b28-16+/t21-/m0/s1 |
| InChIKey | WETLONCKCTYONU-KQBIVOJMSA-N |
| XLogP | 3.68 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|