C25H23N3O — CID 129439488
N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 129439488) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 129439488 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NN=C[C@@H]3C[C@H]4C=C[C@H]3C4)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H23N3O/c1-16-6-9-18(10-7-16)24-14-22(21-4-2-3-5-23(21)27-24)25(29)28-26-15-20-13-17-8-11-19(20)12-17/h2-11,14-15,17,19-20H,12-13H2,1H3,(H,28,29)/t17-,19-,20-/m0/s1 |
| InChIKey | MIMQTSZUPNOIGL-IHPCNDPISA-N |
| XLogP | 5.14 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|