C18H12Cl2N4O3S — CID 27160642
2,4-dichloro-N-[(Z)-[(5S)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]benzamide (PubChem CID 27160642) has the molecular formula C18H12Cl2N4O3S and a molecular weight of 435.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-[(5S)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-[(5S)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 27160642 |
| Molecular Formula | C18H12Cl2N4O3S |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-[(5S)-4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\[C@H]1C(=O)NC(=S)N(c2ccccc2)C1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H12Cl2N4O3S/c19-10-6-7-12(14(20)8-10)16(26)23-21-9-13-15(25)22-18(28)24(17(13)27)11-4-2-1-3-5-11/h1-9,13H,(H,23,26)(H,22,25,28)/b21-9-/t13-/m0/s1 |
| InChIKey | OWYFNBTYGNEJOQ-YOZVVDKVSA-N |
| XLogP | 2.77 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|