C17H11Cl2N3O2S — CID 4120680
5-[(3,4-dichlorophenyl)iminomethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 4120680) has the molecular formula C17H11Cl2N3O2S and a molecular weight of 392.27 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)iminomethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(3,4-dichlorophenyl)iminomethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 4120680 |
| Molecular Formula | C17H11Cl2N3O2S |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)iminomethyl]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccccc2)C(=O)C1/C=N/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2N3O2S/c18-13-7-6-10(8-14(13)19)20-9-12-15(23)21-17(25)22(16(12)24)11-4-2-1-3-5-11/h1-9,12H,(H,21,23,25)/b20-9+ |
| InChIKey | HXHYQBPTQCILMD-AWQFTUOYSA-N |
| XLogP | 3.76 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|