C18H23ClN4O2S — CID 7000283
1-(3-chlorophenyl)-5-[3-(diethylamino)propyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7000283) has the molecular formula C18H23ClN4O2S and a molecular weight of 394.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-[3-(diethylamino)propyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(3-chlorophenyl)-5-[3-(diethylamino)propyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7000283 |
| Molecular Formula | C18H23ClN4O2S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-(3-chlorophenyl)-5-[3-(diethylamino)propyliminomethyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN(CC)CCC/N=C/C1C(=O)NC(=S)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C18H23ClN4O2S/c1-3-22(4-2)10-6-9-20-12-15-16(24)21-18(26)23(17(15)25)14-8-5-7-13(19)11-14/h5,7-8,11-12,15H,3-4,6,9-10H2,1-2H3,(H,21,24,26)/b20-12+ |
| InChIKey | ZPDPQZCTOSCOAR-UDWIEESQSA-N |
| XLogP | 2.51 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|