C20H28N4O3 — CID 7474512
5-[3-(diethylamino)propyliminomethyl]-1-(3,4-dimethylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7474512) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-[3-(diethylamino)propyliminomethyl]-1-(3,4-dimethylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[3-(diethylamino)propyliminomethyl]-1-(3,4-dimethylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7474512 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 5-[3-(diethylamino)propyliminomethyl]-1-(3,4-dimethylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCN(CC)CCC/N=C/C1C(=O)NC(=O)N(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C20H28N4O3/c1-5-23(6-2)11-7-10-21-13-17-18(25)22-20(27)24(19(17)26)16-9-8-14(3)15(4)12-16/h8-9,12-13,17H,5-7,10-11H2,1-4H3,(H,22,25,27)/b21-13+ |
| InChIKey | FISJTOYPVJLFSB-FYJGNVAPSA-N |
| XLogP | 2.31 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|