C15H19N3O2 — CID 10107347
3-ethyl-6-(3-ethyl-4-methylanilino)-1H-pyrimidine-2,4-dione (PubChem CID 10107347) has the molecular formula C15H19N3O2 and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-ethyl-6-(3-ethyl-4-methylanilino)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-ethyl-6-(3-ethyl-4-methylanilino)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10107347 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-ethyl-6-(3-ethyl-4-methylanilino)-1H-pyrimidine-2,4-dione |
| SMILES | CCC1=C(C=CC(=C1)NC2=CC(=O)N(C(=O)N2)CC)C |
| InChI | InChI=1S/C15H19N3O2/c1-4-11-8-12(7-6-10(11)3)16-13-9-14(19)18(5-2)15(20)17-13/h6-9,16H,4-5H2,1-3H3,(H,17,20) |
| InChIKey | MZYHTCQEHQZUIZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 419 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |