C23H24N2O — CID 3687938
1,1-dibenzyl-3-(3,4-dimethylphenyl)urea (PubChem CID 3687938) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 1,1-dibenzyl-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1,1-dibenzyl-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 3687938 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1,1-dibenzyl-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N(Cc2ccccc2)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C23H24N2O/c1-18-13-14-22(15-19(18)2)24-23(26)25(16-20-9-5-3-6-10-20)17-21-11-7-4-8-12-21/h3-15H,16-17H2,1-2H3,(H,24,26) |
| InChIKey | BBCOEADOJWPHKO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |