C17H22N6O2 — CID 11759662
3-(4-azidobutyl)-6-(3-ethyl-4-methylanilino)-1H-pyrimidine-2,4-dione (PubChem CID 11759662) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-(4-azidobutyl)-6-(3-ethyl-4-methylanilino)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(4-azidobutyl)-6-(3-ethyl-4-methylanilino)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11759662 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-(4-azidobutyl)-6-(3-ethyl-4-methylanilino)-1H-pyrimidine-2,4-dione |
| SMILES | CCc1cc(Nc2cc(=O)n(CCCCN=[N+]=[N-])c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C17H22N6O2/c1-3-13-10-14(7-6-12(13)2)20-15-11-16(24)23(17(25)21-15)9-5-4-8-19-22-18/h6-7,10-11,20H,3-5,8-9H2,1-2H3,(H,21,25) |
| InChIKey | VHSOOOVDJZZZLS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|