C12H12N2O2S — CID 7027407
(5S)-5-ethyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7027407) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is (5S)-5-ethyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5S)-5-ethyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7027407 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (5S)-5-ethyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CC[C@H]1C(=O)NC(=S)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H12N2O2S/c1-2-9-10(15)13-12(17)14(11(9)16)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,13,15,17)/t9-/m0/s1 |
| InChIKey | ADWDYPCDHYOMJO-VIFPVBQESA-N |
| XLogP | 1.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|