C14H16N2O2S — CID 6566015
(5S)-5-butyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 6566015) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is (5S)-5-butyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5S)-5-butyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 6566015 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (5S)-5-butyl-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCC[C@H]1C(=O)NC(=S)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C14H16N2O2S/c1-2-3-9-11-12(17)15-14(19)16(13(11)18)10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3,(H,15,17,19)/t11-/m0/s1 |
| InChIKey | PLJKTMOISMJXJF-NSHDSACASA-N |
| XLogP | 2.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|