C13H16CuN2O2 — CID 154984150
4-butyl-1-phenylpyrazolidine-3,5-dione;copper (PubChem CID 154984150) has the molecular formula C13H16CuN2O2 and a molecular weight of 295.83 g/mol. Its IUPAC name is 4-butyl-1-phenylpyrazolidine-3,5-dione;copper.
| Compound Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;copper |
|---|---|
| PubChem CID | 154984150 |
| Molecular Formula | C13H16CuN2O2 |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;copper |
| SMILES | CCCCC1C(=O)NN(c2ccccc2)C1=O.[Cu] |
| InChI | InChI=1S/C13H16N2O2.Cu/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;/h4-8,11H,2-3,9H2,1H3,(H,14,16); |
| InChIKey | WRNVRHIKGBKJKX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|