C17H26N2O6 — CID 66639832
4-butyl-1-phenylpyrazolidine-3,5-dione;2-hydroxyethyl acetate;hydrate (PubChem CID 66639832) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is 4-butyl-1-phenylpyrazolidine-3,5-dione;2-hydroxyethyl acetate;hydrate.
| Compound Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;2-hydroxyethyl acetate;hydrate |
|---|---|
| PubChem CID | 66639832 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;2-hydroxyethyl acetate;hydrate |
| SMILES | CC(=O)OCCO.CCCCC1C(=O)NN(c2ccccc2)C1=O.O |
| InChI | InChI=1S/C13H16N2O2.C4H8O3.H2O/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;1-4(6)7-3-2-5;/h4-8,11H,2-3,9H2,1H3,(H,14,16);5H,2-3H2,1H3;1H2 |
| InChIKey | ZOWMCYOKYOLZNH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|