C17H20N2O7 — CID 69043936
4-butyl-1-phenylpyrazolidine-3,5-dione;(Z)-2-hydroxybut-2-enedioic acid (PubChem CID 69043936) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is 4-butyl-1-phenylpyrazolidine-3,5-dione;(Z)-2-hydroxybut-2-enedioic acid.
| Compound Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;(Z)-2-hydroxybut-2-enedioic acid |
|---|---|
| PubChem CID | 69043936 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;(Z)-2-hydroxybut-2-enedioic acid |
| SMILES | CCCCC1C(=O)NN(c2ccccc2)C1=O.O=C(O)/C=C(\O)C(=O)O |
| InChI | InChI=1S/C13H16N2O2.C4H4O5/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;5-2(4(8)9)1-3(6)7/h4-8,11H,2-3,9H2,1H3,(H,14,16);1,5H,(H,6,7)(H,8,9)/b;2-1- |
| InChIKey | XNUGTASODRVLCJ-BTJKTKAUSA-N |
| XLogP | 1.47 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|