C23H32N2O5 — CID 67592030
benzene-1,3-diol;4-butyl-1-phenylpyrazolidine-3,5-dione;ethoxyethane (PubChem CID 67592030) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is benzene-1,3-diol;4-butyl-1-phenylpyrazolidine-3,5-dione;ethoxyethane.
| Compound Name | benzene-1,3-diol;4-butyl-1-phenylpyrazolidine-3,5-dione;ethoxyethane |
|---|---|
| PubChem CID | 67592030 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | benzene-1,3-diol;4-butyl-1-phenylpyrazolidine-3,5-dione;ethoxyethane |
| SMILES | CCCCC1C(=O)NN(c2ccccc2)C1=O.CCOCC.Oc1cccc(O)c1 |
| InChI | InChI=1S/C13H16N2O2.C6H6O2.C4H10O/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;7-5-2-1-3-6(8)4-5;1-3-5-4-2/h4-8,11H,2-3,9H2,1H3,(H,14,16);1-4,7-8H;3-4H2,1-2H3 |
| InChIKey | AFFVSSOYJKVIJN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|