C32H36N4O4 — CID 175307489
4-butyl-1,2-diphenylpyrazolidine-3,5-dione;4-butyl-1-phenylpyrazolidine-3,5-dione (PubChem CID 175307489) has the molecular formula C32H36N4O4 and a molecular weight of 540.66 g/mol. Its IUPAC name is 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;4-butyl-1-phenylpyrazolidine-3,5-dione.
| Compound Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;4-butyl-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 175307489 |
| Molecular Formula | C32H36N4O4 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;4-butyl-1-phenylpyrazolidine-3,5-dione |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.CCCCC1C(=O)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N2O2.C13H16N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10/h4-13,17H,2-3,14H2,1H3;4-8,11H,2-3,9H2,1H3,(H,14,16) |
| InChIKey | YIYOYQFMJYOCAI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|