C18H24N2O6 — CID 68646218
4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid (PubChem CID 68646218) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid.
| Compound Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid |
|---|---|
| PubChem CID | 68646218 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid |
| SMILES | CCCCC1C(=O)NN(c2ccccc2)C1=O.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C13H16N2O2.C5H8O4/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;6-4(7)2-1-3-5(8)9/h4-8,11H,2-3,9H2,1H3,(H,14,16);1-3H2,(H,6,7)(H,8,9) |
| InChIKey | XMYRTGAGFPPJIG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|