4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid

C18H24N2O6 — CID 68646218

IUPAC4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid
SMILESCCCCC1C(=O)NN(c2ccccc2)C1=O.O=C(O)CCCC(=O)O
InChIInChI=1S/C13H16N2O2.C5H8O4/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;6-4(7)2-1-3-5(8)9/h4-8,11H,2-3,9H2,1H3,(H,14,16);1-3H2,(H,6,7)(H,8,9)
InChIKeyXMYRTGAGFPPJIG-UHFFFAOYSA-N
MW364.40 g/mol
LogP2.20
Rot. Bonds8

About 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid

4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid (PubChem CID 68646218) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid.

Molecular Properties

Compound Name4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid
PubChem CID68646218
Molecular FormulaC18H24N2O6
Molecular Weight364.40 g/mol
Exact Mass364.16
IUPAC Name4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid
SMILESCCCCC1C(=O)NN(c2ccccc2)C1=O.O=C(O)CCCC(=O)O
InChIInChI=1S/C13H16N2O2.C5H8O4/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;6-4(7)2-1-3-5(8)9/h4-8,11H,2-3,9H2,1H3,(H,14,16);1-3H2,(H,6,7)(H,8,9)
InChIKeyXMYRTGAGFPPJIG-UHFFFAOYSA-N
XLogP2.20
TPSA124.01 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500364.40
LogP ≤ 52.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid?
The IUPAC name of 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid (CID 68646218) is 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid.
What is the SMILES notation for 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid?
The canonical SMILES for 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid is CCCCC1C(=O)NN(c2ccccc2)C1=O.O=C(O)CCCC(=O)O.
What is the InChIKey of 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid?
The InChIKey is XMYRTGAGFPPJIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2.C5H8O4/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;6-4(7)2-1-3-5(8)9/h4-8,11H,2-3,9H2,1H3,(H,14,16);1-3H2,(H,6,7)(H,8,9).
What are the key properties of 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid?
4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid has a molecular weight of 364.40 g/mol, XLogP of 2.20, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1-phenylpyrazolidine-3,5-dione;pentanedioic acid is sourced from PubChem (CID 68646218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).