C28H34Cl2N6O5S2 — CID 137321522
bis(1-(4-chlorophenyl)-5-(diethylamino)-2-sulfanylidene-1,3-diazinane-4,6-dione);hydrate (PubChem CID 137321522) has the molecular formula C28H34Cl2N6O5S2 and a molecular weight of 669.66 g/mol. Its IUPAC name is bis(1-(4-chlorophenyl)-5-(diethylamino)-2-sulfanylidene-1,3-diazinane-4,6-dione);hydrate.
| Compound Name | bis(1-(4-chlorophenyl)-5-(diethylamino)-2-sulfanylidene-1,3-diazinane-4,6-dione);hydrate |
|---|---|
| PubChem CID | 137321522 |
| Molecular Formula | C28H34Cl2N6O5S2 |
| Molecular Weight | 669.66 g/mol |
| Exact Mass | 668.14 |
| IUPAC Name | bis(1-(4-chlorophenyl)-5-(diethylamino)-2-sulfanylidene-1,3-diazinane-4,6-dione);hydrate |
| SMILES | CCN(CC)C1C(=O)NC(=S)N(c2ccc(Cl)cc2)C1=O.CCN(CC)C1C(=O)NC(=S)N(c2ccc(Cl)cc2)C1=O.O |
| InChI | InChI=1S/2C14H16ClN3O2S.H2O/c2*1-3-17(4-2)11-12(19)16-14(21)18(13(11)20)10-7-5-9(15)6-8-10;/h2*5-8,11H,3-4H2,1-2H3,(H,16,19,21);1H2 |
| InChIKey | DZHQZYIENJZDNH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.66 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|