C14H17ClN4O2S — CID 57397441
N-(1-carbamothioylpiperidin-4-yl)-N'-(4-chlorophenyl)oxamide (PubChem CID 57397441) has the molecular formula C14H17ClN4O2S and a molecular weight of 340.84 g/mol. Its IUPAC name is N-(1-carbamothioylpiperidin-4-yl)-N'-(4-chlorophenyl)oxamide.
| Compound Name | N-(1-carbamothioylpiperidin-4-yl)-N'-(4-chlorophenyl)oxamide |
|---|---|
| PubChem CID | 57397441 |
| Molecular Formula | C14H17ClN4O2S |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-(1-carbamothioylpiperidin-4-yl)-N'-(4-chlorophenyl)oxamide |
| SMILES | NC(=S)N1CCC(NC(=O)C(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H17ClN4O2S/c15-9-1-3-10(4-2-9)17-12(20)13(21)18-11-5-7-19(8-6-11)14(16)22/h1-4,11H,5-8H2,(H2,16,22)(H,17,20)(H,18,21) |
| InChIKey | VSBSPRRKYPIGTQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|