C17H23N4O4+ — CID 7368024
3-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium (PubChem CID 7368024) has the molecular formula C17H23N4O4+ and a molecular weight of 347.40 g/mol. Its IUPAC name is 3-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium.
| Compound Name | 3-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7368024 |
| Molecular Formula | C17H23N4O4+ |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium |
| SMILES | COc1ccc(N2C(=O)NC(=O)C(/C=N/CCC[NH+](C)C)C2=O)cc1 |
| InChI | InChI=1S/C17H22N4O4/c1-20(2)10-4-9-18-11-14-15(22)19-17(24)21(16(14)23)12-5-7-13(25-3)8-6-12/h5-8,11,14H,4,9-10H2,1-3H3,(H,19,22,24)/p+1/b18-11+ |
| InChIKey | NKOKURGAVOHEMR-WOJGMQOQSA-O |
| XLogP | -0.50 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|