C20H18FN3O4 — CID 7584153
1-(4-fluorophenyl)-5-[2-(4-methoxyphenyl)ethyliminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7584153) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-[2-(4-methoxyphenyl)ethyliminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-fluorophenyl)-5-[2-(4-methoxyphenyl)ethyliminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7584153 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-(4-fluorophenyl)-5-[2-(4-methoxyphenyl)ethyliminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(CC/N=C/C2C(=O)NC(=O)N(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H18FN3O4/c1-28-16-8-2-13(3-9-16)10-11-22-12-17-18(25)23-20(27)24(19(17)26)15-6-4-14(21)5-7-15/h2-9,12,17H,10-11H2,1H3,(H,23,25,27)/b22-12+ |
| InChIKey | KSDDYHRLTBJIHG-WSDLNYQXSA-N |
| XLogP | 2.35 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|