C19H17N3O4S — CID 9311986
(4R)-4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-pyridin-2-yl-4H-isoquinoline-1,3-dione (PubChem CID 9311986) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is (4R)-4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-pyridin-2-yl-4H-isoquinoline-1,3-dione.
| Compound Name | (4R)-4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-pyridin-2-yl-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9311986 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (4R)-4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-pyridin-2-yl-4H-isoquinoline-1,3-dione |
| SMILES | O=C1c2ccccc2[C@H](/C=N/[C@@H]2CCS(=O)(=O)C2)C(=O)N1c1ccccn1 |
| InChI | InChI=1S/C19H17N3O4S/c23-18-15-6-2-1-5-14(15)16(11-21-13-8-10-27(25,26)12-13)19(24)22(18)17-7-3-4-9-20-17/h1-7,9,11,13,16H,8,10,12H2/b21-11+/t13-,16+/m1/s1 |
| InChIKey | QCYOVSZZIGXAQW-IOHGSSEGSA-N |
| XLogP | 1.61 |
| TPSA | 96.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|