C22H18N4O2 — CID 9312367
2-pyridin-2-yl-4-[[(1S)-1-pyridin-4-ylethyl]iminomethyl]-4H-isoquinoline-1,3-dione (PubChem CID 9312367) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-pyridin-2-yl-4-[[(1S)-1-pyridin-4-ylethyl]iminomethyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 2-pyridin-2-yl-4-[[(1S)-1-pyridin-4-ylethyl]iminomethyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9312367 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-pyridin-2-yl-4-[[(1S)-1-pyridin-4-ylethyl]iminomethyl]-4H-isoquinoline-1,3-dione |
| SMILES | C[C@H](/N=C/C1C(=O)N(c2ccccn2)C(=O)c2ccccc21)c1ccncc1 |
| InChI | InChI=1S/C22H18N4O2/c1-15(16-9-12-23-13-10-16)25-14-19-17-6-2-3-7-18(17)21(27)26(22(19)28)20-8-4-5-11-24-20/h2-15,19H,1H3/b25-14+/t15-,19?/m0/s1 |
| InChIKey | NGGPKJHTIVMFMP-QYCJIKBMSA-N |
| XLogP | 3.58 |
| TPSA | 75.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|