C26H30N2O3 — CID 11909136
4-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]iminomethyl]-2-[(4-methoxyphenyl)methyl]-4H-isoquinoline-1,3-dione (PubChem CID 11909136) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]iminomethyl]-2-[(4-methoxyphenyl)methyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 4-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]iminomethyl]-2-[(4-methoxyphenyl)methyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 11909136 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 4-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]iminomethyl]-2-[(4-methoxyphenyl)methyl]-4H-isoquinoline-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C(/C=N/[C@@H]3CCC[C@@H](C)[C@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-17-7-6-10-24(18(17)2)27-15-23-21-8-4-5-9-22(21)25(29)28(26(23)30)16-19-11-13-20(31-3)14-12-19/h4-5,8-9,11-15,17-18,23-24H,6-7,10,16H2,1-3H3/b27-15+/t17-,18-,23?,24-/m1/s1 |
| InChIKey | JRRDZORUMNGPTQ-MEOUJUAISA-N |
| XLogP | 4.86 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|