C24H21N3O3 — CID 7596216
(4S)-2-[(4-methoxyphenyl)methyl]-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione (PubChem CID 7596216) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is (4S)-2-[(4-methoxyphenyl)methyl]-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4S)-2-[(4-methoxyphenyl)methyl]-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 7596216 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (4S)-2-[(4-methoxyphenyl)methyl]-4-(pyridin-2-ylmethyliminomethyl)-4H-isoquinoline-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3[C@@H](/C=N/Cc3ccccn3)C2=O)cc1 |
| InChI | InChI=1S/C24H21N3O3/c1-30-19-11-9-17(10-12-19)16-27-23(28)21-8-3-2-7-20(21)22(24(27)29)15-25-14-18-6-4-5-13-26-18/h2-13,15,22H,14,16H2,1H3/b25-15+/t22-/m1/s1 |
| InChIKey | MMZGIMPFWSAZBB-BHSKHCGUSA-N |
| XLogP | 3.63 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|