C28H29N5O7S — CID 155543725
4-[2-[[2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 155543725) has the molecular formula C28H29N5O7S and a molecular weight of 579.64 g/mol. Its IUPAC name is 4-[2-[[2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[[2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 155543725 |
| Molecular Formula | C28H29N5O7S |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 4-[2-[[2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCOc1ccc(N2C(=O)c3ccccc3C(C=NNc3ccc(S(=O)(=O)N(CC)CC)cc3[N+](=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C28H29N5O7S/c1-4-31(5-2)41(38,39)21-15-16-25(26(17-21)33(36)37)30-29-18-24-22-9-7-8-10-23(22)27(34)32(28(24)35)19-11-13-20(14-12-19)40-6-3/h7-18,24,30H,4-6H2,1-3H3 |
| InChIKey | YZNYLXSVEHPYGH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 151.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|