C21H29N2O4+ — CID 7030765
5-(4-methoxyphenyl)-2-(3-morpholin-4-ium-4-ylpropyliminomethyl)cyclohexane-1,3-dione (PubChem CID 7030765) has the molecular formula C21H29N2O4+ and a molecular weight of 373.47 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-(3-morpholin-4-ium-4-ylpropyliminomethyl)cyclohexane-1,3-dione.
| Compound Name | 5-(4-methoxyphenyl)-2-(3-morpholin-4-ium-4-ylpropyliminomethyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7030765 |
| Molecular Formula | C21H29N2O4+ |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-(3-morpholin-4-ium-4-ylpropyliminomethyl)cyclohexane-1,3-dione |
| SMILES | COc1ccc(C2CC(=O)C(/C=N/CCC[NH+]3CCOCC3)C(=O)C2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-26-18-5-3-16(4-6-18)17-13-20(24)19(21(25)14-17)15-22-7-2-8-23-9-11-27-12-10-23/h3-6,15,17,19H,2,7-14H2,1H3/p+1/b22-15+ |
| InChIKey | LTCFJCUNUNPFMB-PXLXIMEGSA-O |
| XLogP | 0.70 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|